C17H20N2S3 — CID 9284073
1,3-bis(2-phenylsulfanylethyl)thiourea (PubChem CID 9284073) has the molecular formula C17H20N2S3 and a molecular weight of 348.56 g/mol. Its IUPAC name is 1,3-bis(2-phenylsulfanylethyl)thiourea.
| Compound Name | 1,3-bis(2-phenylsulfanylethyl)thiourea |
|---|---|
| PubChem CID | 9284073 |
| Molecular Formula | C17H20N2S3 |
| Molecular Weight | 348.56 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | 1,3-bis(2-phenylsulfanylethyl)thiourea |
| SMILES | S=C(NCCSc1ccccc1)NCCSc1ccccc1 |
| InChI | InChI=1S/C17H20N2S3/c20-17(18-11-13-21-15-7-3-1-4-8-15)19-12-14-22-16-9-5-2-6-10-16/h1-10H,11-14H2,(H2,18,19,20) |
| InChIKey | FTSDZKLRAOZKJD-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.56 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|