C14H20N2OS2 — CID 9284064
1-[[(2S)-oxolan-2-yl]methyl]-3-(2-phenylsulfanylethyl)thiourea (PubChem CID 9284064) has the molecular formula C14H20N2OS2 and a molecular weight of 296.46 g/mol. Its IUPAC name is 1-[[(2S)-oxolan-2-yl]methyl]-3-(2-phenylsulfanylethyl)thiourea.
| Compound Name | 1-[[(2S)-oxolan-2-yl]methyl]-3-(2-phenylsulfanylethyl)thiourea |
|---|---|
| PubChem CID | 9284064 |
| Molecular Formula | C14H20N2OS2 |
| Molecular Weight | 296.46 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 1-[[(2S)-oxolan-2-yl]methyl]-3-(2-phenylsulfanylethyl)thiourea |
| SMILES | S=C(NCCSc1ccccc1)NC[C@@H]1CCCO1 |
| InChI | InChI=1S/C14H20N2OS2/c18-14(16-11-12-5-4-9-17-12)15-8-10-19-13-6-2-1-3-7-13/h1-3,6-7,12H,4-5,8-11H2,(H2,15,16,18)/t12-/m0/s1 |
| InChIKey | LEDSBYOCAQRSLH-LBPRGKRZSA-N |
| XLogP | 2.42 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.46 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|