C15H28N4O2S2 — CID 8669320
1-[[(2S)-oxolan-2-yl]methyl]-3-[3-[[(2S)-oxolan-2-yl]methylcarbamothioylamino]propyl]thiourea (PubChem CID 8669320) has the molecular formula C15H28N4O2S2 and a molecular weight of 360.55 g/mol. Its IUPAC name is 1-[[(2S)-oxolan-2-yl]methyl]-3-[3-[[(2S)-oxolan-2-yl]methylcarbamothioylamino]propyl]thiourea.
| Compound Name | 1-[[(2S)-oxolan-2-yl]methyl]-3-[3-[[(2S)-oxolan-2-yl]methylcarbamothioylamino]propyl]thiourea |
|---|---|
| PubChem CID | 8669320 |
| Molecular Formula | C15H28N4O2S2 |
| Molecular Weight | 360.55 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | 1-[[(2S)-oxolan-2-yl]methyl]-3-[3-[[(2S)-oxolan-2-yl]methylcarbamothioylamino]propyl]thiourea |
| SMILES | S=C(NCCCNC(=S)NC[C@@H]1CCCO1)NC[C@@H]1CCCO1 |
| InChI | InChI=1S/C15H28N4O2S2/c22-14(18-10-12-4-1-8-20-12)16-6-3-7-17-15(23)19-11-13-5-2-9-21-13/h12-13H,1-11H2,(H2,16,18,22)(H2,17,19,23)/t12-,13-/m0/s1 |
| InChIKey | RKZJOUWQGAFZIB-STQMWFEESA-N |
| XLogP | 0.66 |
| TPSA | 66.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.55 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|