C12H19ClN4OS — CID 19573140
1-[3-(4-chloropyrazol-1-yl)propyl]-3-(oxolan-2-ylmethyl)thiourea (PubChem CID 19573140) has the molecular formula C12H19ClN4OS and a molecular weight of 302.83 g/mol. Its IUPAC name is 1-[3-(4-chloropyrazol-1-yl)propyl]-3-(oxolan-2-ylmethyl)thiourea.
| Compound Name | 1-[3-(4-chloropyrazol-1-yl)propyl]-3-(oxolan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 19573140 |
| Molecular Formula | C12H19ClN4OS |
| Molecular Weight | 302.83 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 1-[3-(4-chloropyrazol-1-yl)propyl]-3-(oxolan-2-ylmethyl)thiourea |
| SMILES | S=C(NCCCn1cc(Cl)cn1)NCC1CCCO1 |
| InChI | InChI=1S/C12H19ClN4OS/c13-10-7-16-17(9-10)5-2-4-14-12(19)15-8-11-3-1-6-18-11/h7,9,11H,1-6,8H2,(H2,14,15,19) |
| InChIKey | AGIWAPBEYYNJJB-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 51.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.83 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|