C11H19N3O4 — CID 108507620
N-(3-formamidopropyl)-N'-(oxolan-2-ylmethyl)oxamide (PubChem CID 108507620) has the molecular formula C11H19N3O4 and a molecular weight of 257.29 g/mol. Its IUPAC name is N-(3-formamidopropyl)-N'-(oxolan-2-ylmethyl)oxamide.
| Compound Name | N-(3-formamidopropyl)-N'-(oxolan-2-ylmethyl)oxamide |
|---|---|
| PubChem CID | 108507620 |
| Molecular Formula | C11H19N3O4 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | N-(3-formamidopropyl)-N'-(oxolan-2-ylmethyl)oxamide |
| SMILES | O=CNCCCNC(=O)C(=O)NCC1CCCO1 |
| InChI | InChI=1S/C11H19N3O4/c15-8-12-4-2-5-13-10(16)11(17)14-7-9-3-1-6-18-9/h8-9H,1-7H2,(H,12,15)(H,13,16)(H,14,17) |
| InChIKey | LFSYGKJDTAHOKS-UHFFFAOYSA-N |
| XLogP | -1.47 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|