C11H18N2O4 — CID 7034176
N-(2-ethenoxyethyl)-N'-[[(2R)-oxolan-2-yl]methyl]oxamide (PubChem CID 7034176) has the molecular formula C11H18N2O4 and a molecular weight of 242.27 g/mol. Its IUPAC name is N-(2-ethenoxyethyl)-N'-[[(2R)-oxolan-2-yl]methyl]oxamide.
| Compound Name | N-(2-ethenoxyethyl)-N'-[[(2R)-oxolan-2-yl]methyl]oxamide |
|---|---|
| PubChem CID | 7034176 |
| Molecular Formula | C11H18N2O4 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | N-(2-ethenoxyethyl)-N'-[[(2R)-oxolan-2-yl]methyl]oxamide |
| SMILES | C=COCCNC(=O)C(=O)NC[C@H]1CCCO1 |
| InChI | InChI=1S/C11H18N2O4/c1-2-16-7-5-12-10(14)11(15)13-8-9-4-3-6-17-9/h2,9H,1,3-8H2,(H,12,14)(H,13,15)/t9-/m1/s1 |
| InChIKey | XCGBFMNVKPWINP-SECBINFHSA-N |
| XLogP | -0.44 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|