About [(2R)-oxolan-2-yl]methyl N-[[(2S)-oxolan-2-yl]methyl]carbamate
[(2R)-oxolan-2-yl]methyl N-[[(2S)-oxolan-2-yl]methyl]carbamate (PubChem CID 100762559) has the molecular formula C11H19NO4
and a molecular weight of 229.28 g/mol. Its IUPAC name is [(2R)-oxolan-2-yl]methyl N-[[(2S)-oxolan-2-yl]methyl]carbamate.
Molecular Properties
| Compound Name | [(2R)-oxolan-2-yl]methyl N-[[(2S)-oxolan-2-yl]methyl]carbamate |
| PubChem CID | 100762559 |
| Molecular Formula | C11H19NO4 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | [(2R)-oxolan-2-yl]methyl N-[[(2S)-oxolan-2-yl]methyl]carbamate |
| SMILES | O=C(NC[C@@H]1CCCO1)OC[C@H]1CCCO1 |
| InChI | InChI=1S/C11H19NO4/c13-11(12-7-9-3-1-5-14-9)16-8-10-4-2-6-15-10/h9-10H,1-8H2,(H,12,13)/t9-,10+/m0/s1 |
| InChIKey | BJLWGFPRUWJSPA-VHSXEESVSA-N |
| XLogP | 1.07 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(2R)-oxolan-2-yl]methyl N-[[(2S)-oxolan-2-yl]methyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-oxolan-2-yl]methyl N-[[(2S)-oxolan-2-yl]methyl]carbamate?
The IUPAC name of [(2R)-oxolan-2-yl]methyl N-[[(2S)-oxolan-2-yl]methyl]carbamate (CID 100762559) is [(2R)-oxolan-2-yl]methyl N-[[(2S)-oxolan-2-yl]methyl]carbamate.
What is the SMILES notation for [(2R)-oxolan-2-yl]methyl N-[[(2S)-oxolan-2-yl]methyl]carbamate?
The canonical SMILES for [(2R)-oxolan-2-yl]methyl N-[[(2S)-oxolan-2-yl]methyl]carbamate is O=C(NC[C@@H]1CCCO1)OC[C@H]1CCCO1.
What is the InChIKey of [(2R)-oxolan-2-yl]methyl N-[[(2S)-oxolan-2-yl]methyl]carbamate?
The InChIKey is BJLWGFPRUWJSPA-VHSXEESVSA-N. The full InChI is InChI=1S/C11H19NO4/c13-11(12-7-9-3-1-5-14-9)16-8-10-4-2-6-15-10/h9-10H,1-8H2,(H,12,13)/t9-,10+/m0/s1.
What are the key properties of [(2R)-oxolan-2-yl]methyl N-[[(2S)-oxolan-2-yl]methyl]carbamate?
[(2R)-oxolan-2-yl]methyl N-[[(2S)-oxolan-2-yl]methyl]carbamate has a molecular weight of 229.28 g/mol, XLogP of 1.07, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-oxolan-2-yl]methyl N-[[(2S)-oxolan-2-yl]methyl]carbamate is sourced from PubChem (CID 100762559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).