C9H16N2O2 — CID 114995836
2-amino-N-(oxolan-2-ylmethyl)cyclopropane-1-carboxamide (PubChem CID 114995836) has the molecular formula C9H16N2O2 and a molecular weight of 184.24 g/mol. Its IUPAC name is 2-amino-N-(oxolan-2-ylmethyl)cyclopropane-1-carboxamide.
| Compound Name | 2-amino-N-(oxolan-2-ylmethyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 114995836 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | 2-amino-N-(oxolan-2-ylmethyl)cyclopropane-1-carboxamide |
| SMILES | NC1CC1C(=O)NCC1CCCO1 |
| InChI | InChI=1S/C9H16N2O2/c10-8-4-7(8)9(12)11-5-6-2-1-3-13-6/h6-8H,1-5,10H2,(H,11,12) |
| InChIKey | UKWUKTHHYWXGSZ-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |