C18H21N3OS — CID 71903145
1-(oxolan-2-ylmethyl)-3-(N-phenylanilino)thiourea (PubChem CID 71903145) has the molecular formula C18H21N3OS and a molecular weight of 327.45 g/mol. Its IUPAC name is 1-(oxolan-2-ylmethyl)-3-(N-phenylanilino)thiourea.
| Compound Name | 1-(oxolan-2-ylmethyl)-3-(N-phenylanilino)thiourea |
|---|---|
| PubChem CID | 71903145 |
| Molecular Formula | C18H21N3OS |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | 1-(oxolan-2-ylmethyl)-3-(N-phenylanilino)thiourea |
| SMILES | S=C(NCC1CCCO1)NN(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H21N3OS/c23-18(19-14-17-12-7-13-22-17)20-21(15-8-3-1-4-9-15)16-10-5-2-6-11-16/h1-6,8-11,17H,7,12-14H2,(H2,19,20,23) |
| InChIKey | DEBJPKDPUVZRLQ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|