C15H22N4S3 — CID 9094657
1-cyclopentyl-3-(2-phenylsulfanylethylcarbamothioylamino)thiourea (PubChem CID 9094657) has the molecular formula C15H22N4S3 and a molecular weight of 354.57 g/mol. Its IUPAC name is 1-cyclopentyl-3-(2-phenylsulfanylethylcarbamothioylamino)thiourea.
| Compound Name | 1-cyclopentyl-3-(2-phenylsulfanylethylcarbamothioylamino)thiourea |
|---|---|
| PubChem CID | 9094657 |
| Molecular Formula | C15H22N4S3 |
| Molecular Weight | 354.57 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | 1-cyclopentyl-3-(2-phenylsulfanylethylcarbamothioylamino)thiourea |
| SMILES | S=C(NCCSc1ccccc1)NNC(=S)NC1CCCC1 |
| InChI | InChI=1S/C15H22N4S3/c20-14(16-10-11-22-13-8-2-1-3-9-13)18-19-15(21)17-12-6-4-5-7-12/h1-3,8-9,12H,4-7,10-11H2,(H2,16,18,20)(H2,17,19,21) |
| InChIKey | FEOWYFPDRPYMQY-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.57 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|