C16H24N2S2 — CID 18282704
1-cyclohexyl-1-methyl-3-(2-phenylsulfanylethyl)thiourea (PubChem CID 18282704) has the molecular formula C16H24N2S2 and a molecular weight of 308.52 g/mol. Its IUPAC name is 1-cyclohexyl-1-methyl-3-(2-phenylsulfanylethyl)thiourea.
| Compound Name | 1-cyclohexyl-1-methyl-3-(2-phenylsulfanylethyl)thiourea |
|---|---|
| PubChem CID | 18282704 |
| Molecular Formula | C16H24N2S2 |
| Molecular Weight | 308.52 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 1-cyclohexyl-1-methyl-3-(2-phenylsulfanylethyl)thiourea |
| SMILES | CN(C(=S)NCCSc1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C16H24N2S2/c1-18(14-8-4-2-5-9-14)16(19)17-12-13-20-15-10-6-3-7-11-15/h3,6-7,10-11,14H,2,4-5,8-9,12-13H2,1H3,(H,17,19) |
| InChIKey | AZOYAACGYYZCQX-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.52 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|