C15H23NS — CID 78962138
N-methyl-N-(2-phenylsulfanylethyl)cyclohexanamine (PubChem CID 78962138) has the molecular formula C15H23NS and a molecular weight of 249.42 g/mol. Its IUPAC name is N-methyl-N-(2-phenylsulfanylethyl)cyclohexanamine.
| Compound Name | N-methyl-N-(2-phenylsulfanylethyl)cyclohexanamine |
|---|---|
| PubChem CID | 78962138 |
| Molecular Formula | C15H23NS |
| Molecular Weight | 249.42 g/mol |
| Exact Mass | 249.16 |
| IUPAC Name | N-methyl-N-(2-phenylsulfanylethyl)cyclohexanamine |
| SMILES | CN(CCSc1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C15H23NS/c1-16(14-8-4-2-5-9-14)12-13-17-15-10-6-3-7-11-15/h3,6-7,10-11,14H,2,4-5,8-9,12-13H2,1H3 |
| InChIKey | QNFASQRXMDLIQI-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.42 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |