C21H36N2S — CID 118584880
N'-tert-butyl-N'-cyclohexyl-N-(3-phenylsulfanylpropyl)ethane-1,2-diamine (PubChem CID 118584880) has the molecular formula C21H36N2S and a molecular weight of 348.60 g/mol. Its IUPAC name is N'-tert-butyl-N'-cyclohexyl-N-(3-phenylsulfanylpropyl)ethane-1,2-diamine.
| Compound Name | N'-tert-butyl-N'-cyclohexyl-N-(3-phenylsulfanylpropyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 118584880 |
| Molecular Formula | C21H36N2S |
| Molecular Weight | 348.60 g/mol |
| Exact Mass | 348.26 |
| IUPAC Name | N'-tert-butyl-N'-cyclohexyl-N-(3-phenylsulfanylpropyl)ethane-1,2-diamine |
| SMILES | CC(C)(C)N(CCNCCCSc1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C21H36N2S/c1-21(2,3)23(19-11-6-4-7-12-19)17-16-22-15-10-18-24-20-13-8-5-9-14-20/h5,8-9,13-14,19,22H,4,6-7,10-12,15-18H2,1-3H3 |
| InChIKey | RXHAZRIYCYIVRZ-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.60 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|