C14H23N3S2 — CID 9284072
1-[3-(dimethylamino)propyl]-3-(2-phenylsulfanylethyl)thiourea (PubChem CID 9284072) has the molecular formula C14H23N3S2 and a molecular weight of 297.49 g/mol. Its IUPAC name is 1-[3-(dimethylamino)propyl]-3-(2-phenylsulfanylethyl)thiourea.
| Compound Name | 1-[3-(dimethylamino)propyl]-3-(2-phenylsulfanylethyl)thiourea |
|---|---|
| PubChem CID | 9284072 |
| Molecular Formula | C14H23N3S2 |
| Molecular Weight | 297.49 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 1-[3-(dimethylamino)propyl]-3-(2-phenylsulfanylethyl)thiourea |
| SMILES | CN(C)CCCNC(=S)NCCSc1ccccc1 |
| InChI | InChI=1S/C14H23N3S2/c1-17(2)11-6-9-15-14(18)16-10-12-19-13-7-4-3-5-8-13/h3-5,7-8H,6,9-12H2,1-2H3,(H2,15,16,18) |
| InChIKey | ALMLETYBGQRTIK-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.49 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|