C11H18N2S — CID 126639034
N',N'-dimethyl-N-phenylsulfanylpropane-1,3-diamine (PubChem CID 126639034) has the molecular formula C11H18N2S and a molecular weight of 210.35 g/mol. Its IUPAC name is N',N'-dimethyl-N-phenylsulfanylpropane-1,3-diamine.
| Compound Name | N',N'-dimethyl-N-phenylsulfanylpropane-1,3-diamine |
|---|---|
| PubChem CID | 126639034 |
| Molecular Formula | C11H18N2S |
| Molecular Weight | 210.35 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | N',N'-dimethyl-N-phenylsulfanylpropane-1,3-diamine |
| SMILES | CN(C)CCCNSc1ccccc1 |
| InChI | InChI=1S/C11H18N2S/c1-13(2)10-6-9-12-14-11-7-4-3-5-8-11/h3-5,7-8,12H,6,9-10H2,1-2H3 |
| InChIKey | MYNWPKLTPCXXSE-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.35 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|