C18H23N3O — CID 3525114
3-[3-(dimethylamino)propyl]-1,1-diphenylurea (PubChem CID 3525114) has the molecular formula C18H23N3O and a molecular weight of 297.40 g/mol. Its IUPAC name is 3-[3-(dimethylamino)propyl]-1,1-diphenylurea.
| Compound Name | 3-[3-(dimethylamino)propyl]-1,1-diphenylurea |
|---|---|
| PubChem CID | 3525114 |
| Molecular Formula | C18H23N3O |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | 3-[3-(dimethylamino)propyl]-1,1-diphenylurea |
| SMILES | CN(C)CCCNC(=O)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H23N3O/c1-20(2)15-9-14-19-18(22)21(16-10-5-3-6-11-16)17-12-7-4-8-13-17/h3-8,10-13H,9,14-15H2,1-2H3,(H,19,22) |
| InChIKey | STFSUSJRZYBMKN-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|