C14H21N3O3 — CID 43135762
2-[methyl-[3-(N-methylanilino)propylcarbamoyl]amino]acetic acid (PubChem CID 43135762) has the molecular formula C14H21N3O3 and a molecular weight of 279.34 g/mol. Its IUPAC name is 2-[methyl-[3-(N-methylanilino)propylcarbamoyl]amino]acetic acid.
| Compound Name | 2-[methyl-[3-(N-methylanilino)propylcarbamoyl]amino]acetic acid |
|---|---|
| PubChem CID | 43135762 |
| Molecular Formula | C14H21N3O3 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 2-[methyl-[3-(N-methylanilino)propylcarbamoyl]amino]acetic acid |
| SMILES | CN(CC(=O)O)C(=O)NCCCN(C)c1ccccc1 |
| InChI | InChI=1S/C14H21N3O3/c1-16(12-7-4-3-5-8-12)10-6-9-15-14(20)17(2)11-13(18)19/h3-5,7-8H,6,9-11H2,1-2H3,(H,15,20)(H,18,19) |
| InChIKey | SJHJOSKQSKZIDT-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|