C14H22N2 — CID 93072425
N',N'-dimethyl-N-[(Z)-3-phenylprop-2-enyl]propane-1,3-diamine (PubChem CID 93072425) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is N',N'-dimethyl-N-[(Z)-3-phenylprop-2-enyl]propane-1,3-diamine.
| Compound Name | N',N'-dimethyl-N-[(Z)-3-phenylprop-2-enyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 93072425 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | N',N'-dimethyl-N-[(Z)-3-phenylprop-2-enyl]propane-1,3-diamine |
| SMILES | CN(C)CCCNC/C=C\c1ccccc1 |
| InChI | InChI=1S/C14H22N2/c1-16(2)13-7-12-15-11-6-10-14-8-4-3-5-9-14/h3-6,8-10,15H,7,11-13H2,1-2H3/b10-6- |
| InChIKey | FACUYLWXOKZJLN-POHAHGRESA-N |
| XLogP | 2.24 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|