C20H36Cl2N2 — CID 17214509
N',N'-dibutyl-N-[(E)-3-phenylprop-2-enyl]propane-1,3-diamine;dihydrochloride (PubChem CID 17214509) has the molecular formula C20H36Cl2N2 and a molecular weight of 375.43 g/mol. Its IUPAC name is N',N'-dibutyl-N-[(E)-3-phenylprop-2-enyl]propane-1,3-diamine;dihydrochloride.
| Compound Name | N',N'-dibutyl-N-[(E)-3-phenylprop-2-enyl]propane-1,3-diamine;dihydrochloride |
|---|---|
| PubChem CID | 17214509 |
| Molecular Formula | C20H36Cl2N2 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 374.23 |
| IUPAC Name | N',N'-dibutyl-N-[(E)-3-phenylprop-2-enyl]propane-1,3-diamine;dihydrochloride |
| SMILES | CCCCN(CCCC)CCCNC/C=C/c1ccccc1.Cl.Cl |
| InChI | InChI=1S/C20H34N2.2ClH/c1-3-5-17-22(18-6-4-2)19-11-16-21-15-10-14-20-12-8-7-9-13-20;;/h7-10,12-14,21H,3-6,11,15-19H2,1-2H3;2*1H/b14-10+;; |
| InChIKey | RPDGHAGMQVHETG-YZEJZXAXSA-N |
| XLogP | 5.43 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|