C12H20N2S — CID 114525043
N',N'-dimethyl-N-(4-methylsulfanylphenyl)propane-1,3-diamine (PubChem CID 114525043) has the molecular formula C12H20N2S and a molecular weight of 224.37 g/mol. Its IUPAC name is N',N'-dimethyl-N-(4-methylsulfanylphenyl)propane-1,3-diamine.
| Compound Name | N',N'-dimethyl-N-(4-methylsulfanylphenyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 114525043 |
| Molecular Formula | C12H20N2S |
| Molecular Weight | 224.37 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | N',N'-dimethyl-N-(4-methylsulfanylphenyl)propane-1,3-diamine |
| SMILES | CSc1ccc(NCCCN(C)C)cc1 |
| InChI | InChI=1S/C12H20N2S/c1-14(2)10-4-9-13-11-5-7-12(15-3)8-6-11/h5-8,13H,4,9-10H2,1-3H3 |
| InChIKey | NKALUXPCKYBMFU-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.37 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|