C13H23FN2S — CID 171543343
N',N'-dimethylbutane-1,4-diamine;1-fluoro-4-methylsulfanylbenzene (PubChem CID 171543343) has the molecular formula C13H23FN2S and a molecular weight of 258.41 g/mol. Its IUPAC name is N',N'-dimethylbutane-1,4-diamine;1-fluoro-4-methylsulfanylbenzene.
| Compound Name | N',N'-dimethylbutane-1,4-diamine;1-fluoro-4-methylsulfanylbenzene |
|---|---|
| PubChem CID | 171543343 |
| Molecular Formula | C13H23FN2S |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | N',N'-dimethylbutane-1,4-diamine;1-fluoro-4-methylsulfanylbenzene |
| SMILES | CN(C)CCCCN.CSc1ccc(F)cc1 |
| InChI | InChI=1S/C7H7FS.C6H16N2/c1-9-7-4-2-6(8)3-5-7;1-8(2)6-4-3-5-7/h2-5H,1H3;3-7H2,1-2H3 |
| InChIKey | ORBBLMMZQJBKQG-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|