C13H21FN2 — CID 94259582
N'-[2-(4-fluorophenyl)ethyl]-N'-methylbutane-1,4-diamine (PubChem CID 94259582) has the molecular formula C13H21FN2 and a molecular weight of 224.32 g/mol. Its IUPAC name is N'-[2-(4-fluorophenyl)ethyl]-N'-methylbutane-1,4-diamine.
| Compound Name | N'-[2-(4-fluorophenyl)ethyl]-N'-methylbutane-1,4-diamine |
|---|---|
| PubChem CID | 94259582 |
| Molecular Formula | C13H21FN2 |
| Molecular Weight | 224.32 g/mol |
| Exact Mass | 224.17 |
| IUPAC Name | N'-[2-(4-fluorophenyl)ethyl]-N'-methylbutane-1,4-diamine |
| SMILES | CN(CCCCN)CCc1ccc(F)cc1 |
| InChI | InChI=1S/C13H21FN2/c1-16(10-3-2-9-15)11-8-12-4-6-13(14)7-5-12/h4-7H,2-3,8-11,15H2,1H3 |
| InChIKey | UNKBPAHFMUUSMX-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.32 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|