C9H14N2S — CID 15686149
N'-(4-methylsulfanylphenyl)ethane-1,2-diamine (PubChem CID 15686149) has the molecular formula C9H14N2S and a molecular weight of 182.29 g/mol. Its IUPAC name is N'-(4-methylsulfanylphenyl)ethane-1,2-diamine.
| Compound Name | N'-(4-methylsulfanylphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 15686149 |
| Molecular Formula | C9H14N2S |
| Molecular Weight | 182.29 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | N'-(4-methylsulfanylphenyl)ethane-1,2-diamine |
| SMILES | CSc1ccc(NCCN)cc1 |
| InChI | InChI=1S/C9H14N2S/c1-12-9-4-2-8(3-5-9)11-7-6-10/h2-5,11H,6-7,10H2,1H3 |
| InChIKey | PLSIHOSSKFSNJY-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.29 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |