C13H21N3OS — CID 77061906
N'-hydroxy-2,2-dimethyl-4-(4-methylsulfanylanilino)butanimidamide (PubChem CID 77061906) has the molecular formula C13H21N3OS and a molecular weight of 267.40 g/mol. Its IUPAC name is N'-hydroxy-2,2-dimethyl-4-(4-methylsulfanylanilino)butanimidamide.
| Compound Name | N'-hydroxy-2,2-dimethyl-4-(4-methylsulfanylanilino)butanimidamide |
|---|---|
| PubChem CID | 77061906 |
| Molecular Formula | C13H21N3OS |
| Molecular Weight | 267.40 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | N'-hydroxy-2,2-dimethyl-4-(4-methylsulfanylanilino)butanimidamide |
| SMILES | CSc1ccc(NCCC(C)(C)C(N)=NO)cc1 |
| InChI | InChI=1S/C13H21N3OS/c1-13(2,12(14)16-17)8-9-15-10-4-6-11(18-3)7-5-10/h4-7,15,17H,8-9H2,1-3H3,(H2,14,16) |
| InChIKey | YJCUEXXEZVGBNX-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.40 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|