C14H22BrN3O — CID 107575376
4-(4-bromo-3,5-dimethylanilino)-N'-hydroxy-2,2-dimethylbutanimidamide (PubChem CID 107575376) has the molecular formula C14H22BrN3O and a molecular weight of 328.25 g/mol. Its IUPAC name is 4-(4-bromo-3,5-dimethylanilino)-N'-hydroxy-2,2-dimethylbutanimidamide.
| Compound Name | 4-(4-bromo-3,5-dimethylanilino)-N'-hydroxy-2,2-dimethylbutanimidamide |
|---|---|
| PubChem CID | 107575376 |
| Molecular Formula | C14H22BrN3O |
| Molecular Weight | 328.25 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | 4-(4-bromo-3,5-dimethylanilino)-N'-hydroxy-2,2-dimethylbutanimidamide |
| SMILES | Cc1cc(NCCC(C)(C)/C(N)=N/O)cc(C)c1Br |
| InChI | InChI=1S/C14H22BrN3O/c1-9-7-11(8-10(2)12(9)15)17-6-5-14(3,4)13(16)18-19/h7-8,17,19H,5-6H2,1-4H3,(H2,16,18) |
| InChIKey | REVMZDDLHMFOOO-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.25 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|