C14H22FN3O — CID 77063562
5-(4-fluoro-3-methylanilino)-N'-hydroxy-2,2-dimethylpentanimidamide (PubChem CID 77063562) has the molecular formula C14H22FN3O and a molecular weight of 267.35 g/mol. Its IUPAC name is 5-(4-fluoro-3-methylanilino)-N'-hydroxy-2,2-dimethylpentanimidamide.
| Compound Name | 5-(4-fluoro-3-methylanilino)-N'-hydroxy-2,2-dimethylpentanimidamide |
|---|---|
| PubChem CID | 77063562 |
| Molecular Formula | C14H22FN3O |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | 5-(4-fluoro-3-methylanilino)-N'-hydroxy-2,2-dimethylpentanimidamide |
| SMILES | Cc1cc(NCCCC(C)(C)C(N)=NO)ccc1F |
| InChI | InChI=1S/C14H22FN3O/c1-10-9-11(5-6-12(10)15)17-8-4-7-14(2,3)13(16)18-19/h5-6,9,17,19H,4,7-8H2,1-3H3,(H2,16,18) |
| InChIKey | ZDUFCKXMNGZWIW-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|