C14H22ClN3O2 — CID 77063921
5-(3-chloro-4-methoxyanilino)-N'-hydroxy-2,2-dimethylpentanimidamide (PubChem CID 77063921) has the molecular formula C14H22ClN3O2 and a molecular weight of 299.80 g/mol. Its IUPAC name is 5-(3-chloro-4-methoxyanilino)-N'-hydroxy-2,2-dimethylpentanimidamide.
| Compound Name | 5-(3-chloro-4-methoxyanilino)-N'-hydroxy-2,2-dimethylpentanimidamide |
|---|---|
| PubChem CID | 77063921 |
| Molecular Formula | C14H22ClN3O2 |
| Molecular Weight | 299.80 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | 5-(3-chloro-4-methoxyanilino)-N'-hydroxy-2,2-dimethylpentanimidamide |
| SMILES | COc1ccc(NCCCC(C)(C)C(N)=NO)cc1Cl |
| InChI | InChI=1S/C14H22ClN3O2/c1-14(2,13(16)18-19)7-4-8-17-10-5-6-12(20-3)11(15)9-10/h5-6,9,17,19H,4,7-8H2,1-3H3,(H2,16,18) |
| InChIKey | YFEHBROMNLYGHJ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 79.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.80 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'} |
|---|