C15H24FN3O — CID 106711027
6-(3-fluoro-4-methylanilino)-N'-hydroxy-2,2-dimethylhexanimidamide (PubChem CID 106711027) has the molecular formula C15H24FN3O and a molecular weight of 281.38 g/mol. Its IUPAC name is 6-(3-fluoro-4-methylanilino)-N'-hydroxy-2,2-dimethylhexanimidamide.
| Compound Name | 6-(3-fluoro-4-methylanilino)-N'-hydroxy-2,2-dimethylhexanimidamide |
|---|---|
| PubChem CID | 106711027 |
| Molecular Formula | C15H24FN3O |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | 6-(3-fluoro-4-methylanilino)-N'-hydroxy-2,2-dimethylhexanimidamide |
| SMILES | Cc1ccc(NCCCCC(C)(C)/C(N)=N/O)cc1F |
| InChI | InChI=1S/C15H24FN3O/c1-11-6-7-12(10-13(11)16)18-9-5-4-8-15(2,3)14(17)19-20/h6-7,10,18,20H,4-5,8-9H2,1-3H3,(H2,17,19) |
| InChIKey | FDWVMDFKHJHVHM-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|