C14H20F3N3O — CID 106711134
N'-hydroxy-2,2-dimethyl-6-(2,4,5-trifluoroanilino)hexanimidamide (PubChem CID 106711134) has the molecular formula C14H20F3N3O and a molecular weight of 303.33 g/mol. Its IUPAC name is N'-hydroxy-2,2-dimethyl-6-(2,4,5-trifluoroanilino)hexanimidamide.
| Compound Name | N'-hydroxy-2,2-dimethyl-6-(2,4,5-trifluoroanilino)hexanimidamide |
|---|---|
| PubChem CID | 106711134 |
| Molecular Formula | C14H20F3N3O |
| Molecular Weight | 303.33 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | N'-hydroxy-2,2-dimethyl-6-(2,4,5-trifluoroanilino)hexanimidamide |
| SMILES | CC(C)(CCCCNc1cc(F)c(F)cc1F)/C(N)=N/O |
| InChI | InChI=1S/C14H20F3N3O/c1-14(2,13(18)20-21)5-3-4-6-19-12-8-10(16)9(15)7-11(12)17/h7-8,19,21H,3-6H2,1-2H3,(H2,18,20) |
| InChIKey | QMXDFSDNLAPTIO-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.33 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'} |
|---|