C13H19ClIN3O — CID 107635920
5-(4-chloro-2-iodoanilino)-N'-hydroxy-2,2-dimethylpentanimidamide (PubChem CID 107635920) has the molecular formula C13H19ClIN3O and a molecular weight of 395.67 g/mol. Its IUPAC name is 5-(4-chloro-2-iodoanilino)-N'-hydroxy-2,2-dimethylpentanimidamide.
| Compound Name | 5-(4-chloro-2-iodoanilino)-N'-hydroxy-2,2-dimethylpentanimidamide |
|---|---|
| PubChem CID | 107635920 |
| Molecular Formula | C13H19ClIN3O |
| Molecular Weight | 395.67 g/mol |
| Exact Mass | 395.03 |
| IUPAC Name | 5-(4-chloro-2-iodoanilino)-N'-hydroxy-2,2-dimethylpentanimidamide |
| SMILES | CC(C)(CCCNc1ccc(Cl)cc1I)/C(N)=N/O |
| InChI | InChI=1S/C13H19ClIN3O/c1-13(2,12(16)18-19)6-3-7-17-11-5-4-9(14)8-10(11)15/h4-5,8,17,19H,3,6-7H2,1-2H3,(H2,16,18) |
| InChIKey | ZUAYRSJIHFTIGE-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.67 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'} |
|---|