C16H27N3O — CID 106711028
6-(2-ethylanilino)-N'-hydroxy-2,2-dimethylhexanimidamide (PubChem CID 106711028) has the molecular formula C16H27N3O and a molecular weight of 277.41 g/mol. Its IUPAC name is 6-(2-ethylanilino)-N'-hydroxy-2,2-dimethylhexanimidamide.
| Compound Name | 6-(2-ethylanilino)-N'-hydroxy-2,2-dimethylhexanimidamide |
|---|---|
| PubChem CID | 106711028 |
| Molecular Formula | C16H27N3O |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.22 |
| IUPAC Name | 6-(2-ethylanilino)-N'-hydroxy-2,2-dimethylhexanimidamide |
| SMILES | CCc1ccccc1NCCCCC(C)(C)/C(N)=N/O |
| InChI | InChI=1S/C16H27N3O/c1-4-13-9-5-6-10-14(13)18-12-8-7-11-16(2,3)15(17)19-20/h5-6,9-10,18,20H,4,7-8,11-12H2,1-3H3,(H2,17,19) |
| InChIKey | ZRWSZAIWKHGWEG-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|