C16H27N3O — CID 77062527
4-(2-tert-butylanilino)-N'-hydroxy-2,2-dimethylbutanimidamide (PubChem CID 77062527) has the molecular formula C16H27N3O and a molecular weight of 277.41 g/mol. Its IUPAC name is 4-(2-tert-butylanilino)-N'-hydroxy-2,2-dimethylbutanimidamide.
| Compound Name | 4-(2-tert-butylanilino)-N'-hydroxy-2,2-dimethylbutanimidamide |
|---|---|
| PubChem CID | 77062527 |
| Molecular Formula | C16H27N3O |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.22 |
| IUPAC Name | 4-(2-tert-butylanilino)-N'-hydroxy-2,2-dimethylbutanimidamide |
| SMILES | CC(C)(CCNc1ccccc1C(C)(C)C)C(N)=NO |
| InChI | InChI=1S/C16H27N3O/c1-15(2,3)12-8-6-7-9-13(12)18-11-10-16(4,5)14(17)19-20/h6-9,18,20H,10-11H2,1-5H3,(H2,17,19) |
| InChIKey | FRANDMCLBSICCD-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|