C13H20BrN3O2 — CID 77069992
4-(2-bromo-5-methoxyanilino)-N'-hydroxy-2,2-dimethylbutanimidamide (PubChem CID 77069992) has the molecular formula C13H20BrN3O2 and a molecular weight of 330.23 g/mol. Its IUPAC name is 4-(2-bromo-5-methoxyanilino)-N'-hydroxy-2,2-dimethylbutanimidamide.
| Compound Name | 4-(2-bromo-5-methoxyanilino)-N'-hydroxy-2,2-dimethylbutanimidamide |
|---|---|
| PubChem CID | 77069992 |
| Molecular Formula | C13H20BrN3O2 |
| Molecular Weight | 330.23 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | 4-(2-bromo-5-methoxyanilino)-N'-hydroxy-2,2-dimethylbutanimidamide |
| SMILES | COc1ccc(Br)c(NCCC(C)(C)C(N)=NO)c1 |
| InChI | InChI=1S/C13H20BrN3O2/c1-13(2,12(15)17-18)6-7-16-11-8-9(19-3)4-5-10(11)14/h4-5,8,16,18H,6-7H2,1-3H3,(H2,15,17) |
| InChIKey | JYWXDPVNMPUPPV-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 79.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.23 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|