C13H20BrN3O — CID 77062127
4-(4-bromo-3-methylanilino)-N'-hydroxy-2,2-dimethylbutanimidamide (PubChem CID 77062127) has the molecular formula C13H20BrN3O and a molecular weight of 314.23 g/mol. Its IUPAC name is 4-(4-bromo-3-methylanilino)-N'-hydroxy-2,2-dimethylbutanimidamide.
| Compound Name | 4-(4-bromo-3-methylanilino)-N'-hydroxy-2,2-dimethylbutanimidamide |
|---|---|
| PubChem CID | 77062127 |
| Molecular Formula | C13H20BrN3O |
| Molecular Weight | 314.23 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | 4-(4-bromo-3-methylanilino)-N'-hydroxy-2,2-dimethylbutanimidamide |
| SMILES | Cc1cc(NCCC(C)(C)C(N)=NO)ccc1Br |
| InChI | InChI=1S/C13H20BrN3O/c1-9-8-10(4-5-11(9)14)16-7-6-13(2,3)12(15)17-18/h4-5,8,16,18H,6-7H2,1-3H3,(H2,15,17) |
| InChIKey | YIMQNRGVNWDUHI-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.23 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|