C16H24N2 — CID 106709014
6-(2-ethylanilino)-2,2-dimethylhexanenitrile (PubChem CID 106709014) has the molecular formula C16H24N2 and a molecular weight of 244.38 g/mol. Its IUPAC name is 6-(2-ethylanilino)-2,2-dimethylhexanenitrile.
| Compound Name | 6-(2-ethylanilino)-2,2-dimethylhexanenitrile |
|---|---|
| PubChem CID | 106709014 |
| Molecular Formula | C16H24N2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | 6-(2-ethylanilino)-2,2-dimethylhexanenitrile |
| SMILES | CCc1ccccc1NCCCCC(C)(C)C#N |
| InChI | InChI=1S/C16H24N2/c1-4-14-9-5-6-10-15(14)18-12-8-7-11-16(2,3)13-17/h5-6,9-10,18H,4,7-8,11-12H2,1-3H3 |
| InChIKey | JQTCAEZASIJJQM-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|