C18H28N2 — CID 106709354
6-(2-tert-butylanilino)-2,2-dimethylhexanenitrile (PubChem CID 106709354) has the molecular formula C18H28N2 and a molecular weight of 272.44 g/mol. Its IUPAC name is 6-(2-tert-butylanilino)-2,2-dimethylhexanenitrile.
| Compound Name | 6-(2-tert-butylanilino)-2,2-dimethylhexanenitrile |
|---|---|
| PubChem CID | 106709354 |
| Molecular Formula | C18H28N2 |
| Molecular Weight | 272.44 g/mol |
| Exact Mass | 272.23 |
| IUPAC Name | 6-(2-tert-butylanilino)-2,2-dimethylhexanenitrile |
| SMILES | CC(C)(C#N)CCCCNc1ccccc1C(C)(C)C |
| InChI | InChI=1S/C18H28N2/c1-17(2,3)15-10-6-7-11-16(15)20-13-9-8-12-18(4,5)14-19/h6-7,10-11,20H,8-9,12-13H2,1-5H3 |
| InChIKey | ZCAYIDJCAVELOB-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.44 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|