C14H18F2N2 — CID 106708998
6-(3,4-difluoroanilino)-2,2-dimethylhexanenitrile (PubChem CID 106708998) has the molecular formula C14H18F2N2 and a molecular weight of 252.31 g/mol. Its IUPAC name is 6-(3,4-difluoroanilino)-2,2-dimethylhexanenitrile.
| Compound Name | 6-(3,4-difluoroanilino)-2,2-dimethylhexanenitrile |
|---|---|
| PubChem CID | 106708998 |
| Molecular Formula | C14H18F2N2 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 6-(3,4-difluoroanilino)-2,2-dimethylhexanenitrile |
| SMILES | CC(C)(C#N)CCCCNc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C14H18F2N2/c1-14(2,10-17)7-3-4-8-18-11-5-6-12(15)13(16)9-11/h5-6,9,18H,3-4,7-8H2,1-2H3 |
| InChIKey | IJOBCOLVENNKFG-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|