C14H17Cl2FN2 — CID 106709544
6-(2,6-dichloro-4-fluoroanilino)-2,2-dimethylhexanenitrile (PubChem CID 106709544) has the molecular formula C14H17Cl2FN2 and a molecular weight of 303.21 g/mol. Its IUPAC name is 6-(2,6-dichloro-4-fluoroanilino)-2,2-dimethylhexanenitrile.
| Compound Name | 6-(2,6-dichloro-4-fluoroanilino)-2,2-dimethylhexanenitrile |
|---|---|
| PubChem CID | 106709544 |
| Molecular Formula | C14H17Cl2FN2 |
| Molecular Weight | 303.21 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 6-(2,6-dichloro-4-fluoroanilino)-2,2-dimethylhexanenitrile |
| SMILES | CC(C)(C#N)CCCCNc1c(Cl)cc(F)cc1Cl |
| InChI | InChI=1S/C14H17Cl2FN2/c1-14(2,9-18)5-3-4-6-19-13-11(15)7-10(17)8-12(13)16/h7-8,19H,3-6H2,1-2H3 |
| InChIKey | YQSNMFGZTRQIOF-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.21 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|