C12H15ClN2 — CID 65249314
4-(4-chloroanilino)-2,2-dimethylbutanenitrile (PubChem CID 65249314) has the molecular formula C12H15ClN2 and a molecular weight of 222.72 g/mol. Its IUPAC name is 4-(4-chloroanilino)-2,2-dimethylbutanenitrile.
| Compound Name | 4-(4-chloroanilino)-2,2-dimethylbutanenitrile |
|---|---|
| PubChem CID | 65249314 |
| Molecular Formula | C12H15ClN2 |
| Molecular Weight | 222.72 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | 4-(4-chloroanilino)-2,2-dimethylbutanenitrile |
| SMILES | CC(C)(C#N)CCNc1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H15ClN2/c1-12(2,9-14)7-8-15-11-5-3-10(13)4-6-11/h3-6,15H,7-8H2,1-2H3 |
| InChIKey | FEAKAPLIZFQBEW-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.72 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |