C14H21N3 — CID 65248476
4-[4-(dimethylamino)anilino]-2,2-dimethylbutanenitrile (PubChem CID 65248476) has the molecular formula C14H21N3 and a molecular weight of 231.34 g/mol. Its IUPAC name is 4-[4-(dimethylamino)anilino]-2,2-dimethylbutanenitrile.
| Compound Name | 4-[4-(dimethylamino)anilino]-2,2-dimethylbutanenitrile |
|---|---|
| PubChem CID | 65248476 |
| Molecular Formula | C14H21N3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.17 |
| IUPAC Name | 4-[4-(dimethylamino)anilino]-2,2-dimethylbutanenitrile |
| SMILES | CN(C)c1ccc(NCCC(C)(C)C#N)cc1 |
| InChI | InChI=1S/C14H21N3/c1-14(2,11-15)9-10-16-12-5-7-13(8-6-12)17(3)4/h5-8,16H,9-10H2,1-4H3 |
| InChIKey | QKFPHDDTSRUALX-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|