C12H20N2 — CID 18322589
1-N-butyl-4-N,4-N-dimethylbenzene-1,4-diamine (PubChem CID 18322589) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is 1-N-butyl-4-N,4-N-dimethylbenzene-1,4-diamine.
| Compound Name | 1-N-butyl-4-N,4-N-dimethylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 18322589 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 1-N-butyl-4-N,4-N-dimethylbenzene-1,4-diamine |
| SMILES | CCCCNc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C12H20N2/c1-4-5-10-13-11-6-8-12(9-7-11)14(2)3/h6-9,13H,4-5,10H2,1-3H3 |
| InChIKey | FNZUEVNNDKNKAK-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|