About 4-butoxy-N-butylaniline
4-butoxy-N-butylaniline (PubChem CID 15112153) has the molecular formula C14H23NO
and a molecular weight of 221.34 g/mol. Its IUPAC name is 4-butoxy-N-butylaniline.
Molecular Properties
| Compound Name | 4-butoxy-N-butylaniline |
| PubChem CID | 15112153 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | 4-butoxy-N-butylaniline |
| SMILES | CCCCNc1ccc(OCCCC)cc1 |
| InChI | InChI=1S/C14H23NO/c1-3-5-11-15-13-7-9-14(10-8-13)16-12-6-4-2/h7-10,15H,3-6,11-12H2,1-2H3 |
| InChIKey | PGSRMAFMJAJUJV-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-butoxy-N-butylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butoxy-N-butylaniline?
The IUPAC name of 4-butoxy-N-butylaniline (CID 15112153) is 4-butoxy-N-butylaniline.
What is the SMILES notation for 4-butoxy-N-butylaniline?
The canonical SMILES for 4-butoxy-N-butylaniline is CCCCNc1ccc(OCCCC)cc1.
What is the InChIKey of 4-butoxy-N-butylaniline?
The InChIKey is PGSRMAFMJAJUJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23NO/c1-3-5-11-15-13-7-9-14(10-8-13)16-12-6-4-2/h7-10,15H,3-6,11-12H2,1-2H3.
What are the key properties of 4-butoxy-N-butylaniline?
4-butoxy-N-butylaniline has a molecular weight of 221.34 g/mol, XLogP of 4.08, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butoxy-N-butylaniline is sourced from PubChem (CID 15112153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).