About N-butyl-4-phenoxyaniline
N-butyl-4-phenoxyaniline (PubChem CID 4712110) has the molecular formula C16H19NO
and a molecular weight of 241.33 g/mol. Its IUPAC name is N-butyl-4-phenoxyaniline.
Molecular Properties
| Compound Name | N-butyl-4-phenoxyaniline |
| PubChem CID | 4712110 |
| Molecular Formula | C16H19NO |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | N-butyl-4-phenoxyaniline |
| SMILES | CCCCNc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C16H19NO/c1-2-3-13-17-14-9-11-16(12-10-14)18-15-7-5-4-6-8-15/h4-12,17H,2-3,13H2,1H3 |
| InChIKey | JKDYZFXLBXXAJM-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-4-phenoxyaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-4-phenoxyaniline?
The IUPAC name of N-butyl-4-phenoxyaniline (CID 4712110) is N-butyl-4-phenoxyaniline.
What is the SMILES notation for N-butyl-4-phenoxyaniline?
The canonical SMILES for N-butyl-4-phenoxyaniline is CCCCNc1ccc(Oc2ccccc2)cc1.
What is the InChIKey of N-butyl-4-phenoxyaniline?
The InChIKey is JKDYZFXLBXXAJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19NO/c1-2-3-13-17-14-9-11-16(12-10-14)18-15-7-5-4-6-8-15/h4-12,17H,2-3,13H2,1H3.
What are the key properties of N-butyl-4-phenoxyaniline?
N-butyl-4-phenoxyaniline has a molecular weight of 241.33 g/mol, XLogP of 4.69, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-4-phenoxyaniline is sourced from PubChem (CID 4712110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).