About N-hexyl-4-phenoxyaniline
N-hexyl-4-phenoxyaniline (PubChem CID 28876890) has the molecular formula C18H23NO
and a molecular weight of 269.39 g/mol. Its IUPAC name is N-hexyl-4-phenoxyaniline.
Molecular Properties
| Compound Name | N-hexyl-4-phenoxyaniline |
| PubChem CID | 28876890 |
| Molecular Formula | C18H23NO |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.18 |
| IUPAC Name | N-hexyl-4-phenoxyaniline |
| SMILES | CCCCCCNc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C18H23NO/c1-2-3-4-8-15-19-16-11-13-18(14-12-16)20-17-9-6-5-7-10-17/h5-7,9-14,19H,2-4,8,15H2,1H3 |
| InChIKey | IIASAEKPFPNCJC-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-hexyl-4-phenoxyaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hexyl-4-phenoxyaniline?
The IUPAC name of N-hexyl-4-phenoxyaniline (CID 28876890) is N-hexyl-4-phenoxyaniline.
What is the SMILES notation for N-hexyl-4-phenoxyaniline?
The canonical SMILES for N-hexyl-4-phenoxyaniline is CCCCCCNc1ccc(Oc2ccccc2)cc1.
What is the InChIKey of N-hexyl-4-phenoxyaniline?
The InChIKey is IIASAEKPFPNCJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23NO/c1-2-3-4-8-15-19-16-11-13-18(14-12-16)20-17-9-6-5-7-10-17/h5-7,9-14,19H,2-4,8,15H2,1H3.
What are the key properties of N-hexyl-4-phenoxyaniline?
N-hexyl-4-phenoxyaniline has a molecular weight of 269.39 g/mol, XLogP of 5.47, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-hexyl-4-phenoxyaniline is sourced from PubChem (CID 28876890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).