C19H34N2O — CID 54807141
N-butyl-N'-(4-heptoxyphenyl)ethane-1,2-diamine (PubChem CID 54807141) has the molecular formula C19H34N2O and a molecular weight of 306.49 g/mol. Its IUPAC name is N-butyl-N'-(4-heptoxyphenyl)ethane-1,2-diamine.
| Compound Name | N-butyl-N'-(4-heptoxyphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 54807141 |
| Molecular Formula | C19H34N2O |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.27 |
| IUPAC Name | N-butyl-N'-(4-heptoxyphenyl)ethane-1,2-diamine |
| SMILES | CCCCCCCOc1ccc(NCCNCCCC)cc1 |
| InChI | InChI=1S/C19H34N2O/c1-3-5-7-8-9-17-22-19-12-10-18(11-13-19)21-16-15-20-14-6-4-2/h10-13,20-21H,3-9,14-17H2,1-2H3 |
| InChIKey | NAADAAJPYJFCCR-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|