C14H20N4O — CID 175377554
N-butyl-5-[4-(dimethylamino)phenyl]-1,3,4-oxadiazol-2-amine (PubChem CID 175377554) has the molecular formula C14H20N4O and a molecular weight of 260.34 g/mol. Its IUPAC name is N-butyl-5-[4-(dimethylamino)phenyl]-1,3,4-oxadiazol-2-amine.
| Compound Name | N-butyl-5-[4-(dimethylamino)phenyl]-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 175377554 |
| Molecular Formula | C14H20N4O |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | N-butyl-5-[4-(dimethylamino)phenyl]-1,3,4-oxadiazol-2-amine |
| SMILES | CCCCNc1nnc(-c2ccc(N(C)C)cc2)o1 |
| InChI | InChI=1S/C14H20N4O/c1-4-5-10-15-14-17-16-13(19-14)11-6-8-12(9-7-11)18(2)3/h6-9H,4-5,10H2,1-3H3,(H,15,17) |
| InChIKey | FXXUQXWUVYIMMU-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 54.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|