C30H27N3O — CID 102175610
4-[4-[4-[5-(4-tert-butylphenyl)-1,3,4-oxadiazol-2-yl]phenyl]buta-1,3-diynyl]-N,N-dimethylaniline (PubChem CID 102175610) has the molecular formula C30H27N3O and a molecular weight of 445.57 g/mol. Its IUPAC name is 4-[4-[4-[5-(4-tert-butylphenyl)-1,3,4-oxadiazol-2-yl]phenyl]buta-1,3-diynyl]-N,N-dimethylaniline.
| Compound Name | 4-[4-[4-[5-(4-tert-butylphenyl)-1,3,4-oxadiazol-2-yl]phenyl]buta-1,3-diynyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 102175610 |
| Molecular Formula | C30H27N3O |
| Molecular Weight | 445.57 g/mol |
| Exact Mass | 445.22 |
| IUPAC Name | 4-[4-[4-[5-(4-tert-butylphenyl)-1,3,4-oxadiazol-2-yl]phenyl]buta-1,3-diynyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(C#CC#Cc2ccc(-c3nnc(-c4ccc(C(C)(C)C)cc4)o3)cc2)cc1 |
| InChI | InChI=1S/C30H27N3O/c1-30(2,3)26-18-16-25(17-19-26)29-32-31-28(34-29)24-14-10-22(11-15-24)8-6-7-9-23-12-20-27(21-13-23)33(4)5/h10-21H,1-5H3 |
| InChIKey | DAWUUYCSONTKFW-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 42.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.57 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|