C12H14ClN3O — CID 39355727
4-[5-(2-chloroethyl)-1,3,4-oxadiazol-2-yl]-N,N-dimethylaniline (PubChem CID 39355727) has the molecular formula C12H14ClN3O and a molecular weight of 251.72 g/mol. Its IUPAC name is 4-[5-(2-chloroethyl)-1,3,4-oxadiazol-2-yl]-N,N-dimethylaniline.
| Compound Name | 4-[5-(2-chloroethyl)-1,3,4-oxadiazol-2-yl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 39355727 |
| Molecular Formula | C12H14ClN3O |
| Molecular Weight | 251.72 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | 4-[5-(2-chloroethyl)-1,3,4-oxadiazol-2-yl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(-c2nnc(CCCl)o2)cc1 |
| InChI | InChI=1S/C12H14ClN3O/c1-16(2)10-5-3-9(4-6-10)12-15-14-11(17-12)7-8-13/h3-6H,7-8H2,1-2H3 |
| InChIKey | ROFMXLONMDNGHM-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 42.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.72 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|