C12H11ClN2O2 — CID 62199935
2-(2-chloroethyl)-5-(2,3-dihydro-1-benzofuran-5-yl)-1,3,4-oxadiazole (PubChem CID 62199935) has the molecular formula C12H11ClN2O2 and a molecular weight of 250.68 g/mol. Its IUPAC name is 2-(2-chloroethyl)-5-(2,3-dihydro-1-benzofuran-5-yl)-1,3,4-oxadiazole.
| Compound Name | 2-(2-chloroethyl)-5-(2,3-dihydro-1-benzofuran-5-yl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 62199935 |
| Molecular Formula | C12H11ClN2O2 |
| Molecular Weight | 250.68 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | 2-(2-chloroethyl)-5-(2,3-dihydro-1-benzofuran-5-yl)-1,3,4-oxadiazole |
| SMILES | ClCCc1nnc(-c2ccc3c(c2)CCO3)o1 |
| InChI | InChI=1S/C12H11ClN2O2/c13-5-3-11-14-15-12(17-11)9-1-2-10-8(7-9)4-6-16-10/h1-2,7H,3-6H2 |
| InChIKey | WRDZJZISAXCPME-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.68 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|