C8H7ClN4O — CID 104669988
2-(2-chloroethyl)-5-pyridazin-4-yl-1,3,4-oxadiazole (PubChem CID 104669988) has the molecular formula C8H7ClN4O and a molecular weight of 210.62 g/mol. Its IUPAC name is 2-(2-chloroethyl)-5-pyridazin-4-yl-1,3,4-oxadiazole.
| Compound Name | 2-(2-chloroethyl)-5-pyridazin-4-yl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 104669988 |
| Molecular Formula | C8H7ClN4O |
| Molecular Weight | 210.62 g/mol |
| Exact Mass | 210.03 |
| IUPAC Name | 2-(2-chloroethyl)-5-pyridazin-4-yl-1,3,4-oxadiazole |
| SMILES | ClCCc1nnc(-c2ccnnc2)o1 |
| InChI | InChI=1S/C8H7ClN4O/c9-3-1-7-12-13-8(14-7)6-2-4-10-11-5-6/h2,4-5H,1,3H2 |
| InChIKey | ZMNVRTOBORDTNV-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 64.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.62 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|